C21H21N5O6S — CID 22517786
N-[3-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-3,4,5-trimethoxybenzamide (PubChem CID 22517786) has the molecular formula C21H21N5O6S and a molecular weight of 471.50 g/mol. Its IUPAC name is N-[3-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 22517786 |
| Molecular Formula | C21H21N5O6S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | N-[3-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1ccc(-c2nnc3sc(NC(=O)c4cc(OC)c(OC)c(OC)c4)nn23)cc1OC |
| InChI | InChI=1S/C21H21N5O6S/c1-28-13-7-6-11(8-14(13)29-2)18-23-24-21-26(18)25-20(33-21)22-19(27)12-9-15(30-3)17(32-5)16(10-12)31-4/h6-10H,1-5H3,(H,22,25,27) |
| InChIKey | YDHJTNCGMNDSDB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |