C18H14FN5O3S — CID 22517796
N-[3-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-3-fluorobenzamide (PubChem CID 22517796) has the molecular formula C18H14FN5O3S and a molecular weight of 399.41 g/mol. Its IUPAC name is N-[3-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-3-fluorobenzamide.
| Compound Name | N-[3-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 22517796 |
| Molecular Formula | C18H14FN5O3S |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N-[3-(3,4-dimethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-3-fluorobenzamide |
| SMILES | COc1ccc(-c2nnc3sc(NC(=O)c4cccc(F)c4)nn23)cc1OC |
| InChI | InChI=1S/C18H14FN5O3S/c1-26-13-7-6-10(9-14(13)27-2)15-21-22-18-24(15)23-17(28-18)20-16(25)11-4-3-5-12(19)8-11/h3-9H,1-2H3,(H,20,23,25) |
| InChIKey | WJSSJOJHDAQMCS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |