C25H22N4O5S — CID 45012563
3,4,5-trimethoxy-N-[4-[(5-phenyl-1,3,4-thiadiazol-2-yl)carbamoyl]phenyl]benzamide (PubChem CID 45012563) has the molecular formula C25H22N4O5S and a molecular weight of 490.54 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[4-[(5-phenyl-1,3,4-thiadiazol-2-yl)carbamoyl]phenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[4-[(5-phenyl-1,3,4-thiadiazol-2-yl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 45012563 |
| Molecular Formula | C25H22N4O5S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 3,4,5-trimethoxy-N-[4-[(5-phenyl-1,3,4-thiadiazol-2-yl)carbamoyl]phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(C(=O)Nc3nnc(-c4ccccc4)s3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H22N4O5S/c1-32-19-13-17(14-20(33-2)21(19)34-3)23(31)26-18-11-9-15(10-12-18)22(30)27-25-29-28-24(35-25)16-7-5-4-6-8-16/h4-14H,1-3H3,(H,26,31)(H,27,29,30) |
| InChIKey | IYKKALQFFWRBTR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |