C25H22N2O5 — CID 46392754
3,4,5-trimethoxy-N-[4-(4-phenyl-1,3-oxazol-2-yl)phenyl]benzamide (PubChem CID 46392754) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[4-(4-phenyl-1,3-oxazol-2-yl)phenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[4-(4-phenyl-1,3-oxazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 46392754 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 3,4,5-trimethoxy-N-[4-(4-phenyl-1,3-oxazol-2-yl)phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(-c3nc(-c4ccccc4)co3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H22N2O5/c1-29-21-13-18(14-22(30-2)23(21)31-3)24(28)26-19-11-9-17(10-12-19)25-27-20(15-32-25)16-7-5-4-6-8-16/h4-15H,1-3H3,(H,26,28) |
| InChIKey | RSFHBWGIEDMXKD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |