C27H25N3O6 — CID 53113500
N-[4-(2-amino-2-oxoethoxy)-2-phenylquinolin-6-yl]-3,4,5-trimethoxybenzamide (PubChem CID 53113500) has the molecular formula C27H25N3O6 and a molecular weight of 487.51 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethoxy)-2-phenylquinolin-6-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[4-(2-amino-2-oxoethoxy)-2-phenylquinolin-6-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 53113500 |
| Molecular Formula | C27H25N3O6 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | N-[4-(2-amino-2-oxoethoxy)-2-phenylquinolin-6-yl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc3nc(-c4ccccc4)cc(OCC(N)=O)c3c2)cc(OC)c1OC |
| InChI | InChI=1S/C27H25N3O6/c1-33-23-11-17(12-24(34-2)26(23)35-3)27(32)29-18-9-10-20-19(13-18)22(36-15-25(28)31)14-21(30-20)16-7-5-4-6-8-16/h4-14H,15H2,1-3H3,(H2,28,31)(H,29,32) |
| InChIKey | LALDAZMJZYDXIQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |