C25H19ClN2O4 — CID 53113511
methyl 2-[6-[(2-chlorobenzoyl)amino]-2-phenylquinolin-4-yl]oxyacetate (PubChem CID 53113511) has the molecular formula C25H19ClN2O4 and a molecular weight of 446.89 g/mol. Its IUPAC name is methyl 2-[6-[(2-chlorobenzoyl)amino]-2-phenylquinolin-4-yl]oxyacetate.
| Compound Name | methyl 2-[6-[(2-chlorobenzoyl)amino]-2-phenylquinolin-4-yl]oxyacetate |
|---|---|
| PubChem CID | 53113511 |
| Molecular Formula | C25H19ClN2O4 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | methyl 2-[6-[(2-chlorobenzoyl)amino]-2-phenylquinolin-4-yl]oxyacetate |
| SMILES | COC(=O)COc1cc(-c2ccccc2)nc2ccc(NC(=O)c3ccccc3Cl)cc12 |
| InChI | InChI=1S/C25H19ClN2O4/c1-31-24(29)15-32-23-14-22(16-7-3-2-4-8-16)28-21-12-11-17(13-19(21)23)27-25(30)18-9-5-6-10-20(18)26/h2-14H,15H2,1H3,(H,27,30) |
| InChIKey | LFUUCKCDKBCTOJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |