C27H25N3O5 — CID 46385068
methyl 2-[6-[(2-ethoxyphenyl)carbamoylamino]-2-phenylquinolin-4-yl]oxyacetate (PubChem CID 46385068) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is methyl 2-[6-[(2-ethoxyphenyl)carbamoylamino]-2-phenylquinolin-4-yl]oxyacetate.
| Compound Name | methyl 2-[6-[(2-ethoxyphenyl)carbamoylamino]-2-phenylquinolin-4-yl]oxyacetate |
|---|---|
| PubChem CID | 46385068 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | methyl 2-[6-[(2-ethoxyphenyl)carbamoylamino]-2-phenylquinolin-4-yl]oxyacetate |
| SMILES | CCOc1ccccc1NC(=O)Nc1ccc2nc(-c3ccccc3)cc(OCC(=O)OC)c2c1 |
| InChI | InChI=1S/C27H25N3O5/c1-3-34-24-12-8-7-11-22(24)30-27(32)28-19-13-14-21-20(15-19)25(35-17-26(31)33-2)16-23(29-21)18-9-5-4-6-10-18/h4-16H,3,17H2,1-2H3,(H2,28,30,32) |
| InChIKey | MBUORVJAOQOJOV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |