C26H22F3N3O2 — CID 50828262
1-[4-ethoxy-2-(4-methylphenyl)quinolin-6-yl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 50828262) has the molecular formula C26H22F3N3O2 and a molecular weight of 465.48 g/mol. Its IUPAC name is 1-[4-ethoxy-2-(4-methylphenyl)quinolin-6-yl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-ethoxy-2-(4-methylphenyl)quinolin-6-yl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 50828262 |
| Molecular Formula | C26H22F3N3O2 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 1-[4-ethoxy-2-(4-methylphenyl)quinolin-6-yl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | CCOc1cc(-c2ccc(C)cc2)nc2ccc(NC(=O)Nc3ccccc3C(F)(F)F)cc12 |
| InChI | InChI=1S/C26H22F3N3O2/c1-3-34-24-15-23(17-10-8-16(2)9-11-17)31-21-13-12-18(14-19(21)24)30-25(33)32-22-7-5-4-6-20(22)26(27,28)29/h4-15H,3H2,1-2H3,(H2,30,32,33) |
| InChIKey | LDSYIXNUXAGGPF-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |