C26H24FN3O2 — CID 50827596
1-(2,4-dimethylphenyl)-3-[4-ethoxy-2-(4-fluorophenyl)quinolin-6-yl]urea (PubChem CID 50827596) has the molecular formula C26H24FN3O2 and a molecular weight of 429.50 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[4-ethoxy-2-(4-fluorophenyl)quinolin-6-yl]urea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[4-ethoxy-2-(4-fluorophenyl)quinolin-6-yl]urea |
|---|---|
| PubChem CID | 50827596 |
| Molecular Formula | C26H24FN3O2 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[4-ethoxy-2-(4-fluorophenyl)quinolin-6-yl]urea |
| SMILES | CCOc1cc(-c2ccc(F)cc2)nc2ccc(NC(=O)Nc3ccc(C)cc3C)cc12 |
| InChI | InChI=1S/C26H24FN3O2/c1-4-32-25-15-24(18-6-8-19(27)9-7-18)29-23-12-10-20(14-21(23)25)28-26(31)30-22-11-5-16(2)13-17(22)3/h5-15H,4H2,1-3H3,(H2,28,30,31) |
| InChIKey | MUKXCEMVUUKYDM-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |