C27H24FN3O4 — CID 46385090
ethyl 2-[6-[(4-fluorophenyl)methylcarbamoylamino]-2-phenylquinolin-4-yl]oxyacetate (PubChem CID 46385090) has the molecular formula C27H24FN3O4 and a molecular weight of 473.50 g/mol. Its IUPAC name is ethyl 2-[6-[(4-fluorophenyl)methylcarbamoylamino]-2-phenylquinolin-4-yl]oxyacetate.
| Compound Name | ethyl 2-[6-[(4-fluorophenyl)methylcarbamoylamino]-2-phenylquinolin-4-yl]oxyacetate |
|---|---|
| PubChem CID | 46385090 |
| Molecular Formula | C27H24FN3O4 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | ethyl 2-[6-[(4-fluorophenyl)methylcarbamoylamino]-2-phenylquinolin-4-yl]oxyacetate |
| SMILES | CCOC(=O)COc1cc(-c2ccccc2)nc2ccc(NC(=O)NCc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C27H24FN3O4/c1-2-34-26(32)17-35-25-15-24(19-6-4-3-5-7-19)31-23-13-12-21(14-22(23)25)30-27(33)29-16-18-8-10-20(28)11-9-18/h3-15H,2,16-17H2,1H3,(H2,29,30,33) |
| InChIKey | YWBMYKZUNYWYCH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |