C26H22FN3O4 — CID 46385080
methyl 2-[6-[(3-fluorophenyl)methylcarbamoylamino]-2-phenylquinolin-4-yl]oxyacetate (PubChem CID 46385080) has the molecular formula C26H22FN3O4 and a molecular weight of 459.48 g/mol. Its IUPAC name is methyl 2-[6-[(3-fluorophenyl)methylcarbamoylamino]-2-phenylquinolin-4-yl]oxyacetate.
| Compound Name | methyl 2-[6-[(3-fluorophenyl)methylcarbamoylamino]-2-phenylquinolin-4-yl]oxyacetate |
|---|---|
| PubChem CID | 46385080 |
| Molecular Formula | C26H22FN3O4 |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | methyl 2-[6-[(3-fluorophenyl)methylcarbamoylamino]-2-phenylquinolin-4-yl]oxyacetate |
| SMILES | COC(=O)COc1cc(-c2ccccc2)nc2ccc(NC(=O)NCc3cccc(F)c3)cc12 |
| InChI | InChI=1S/C26H22FN3O4/c1-33-25(31)16-34-24-14-23(18-7-3-2-4-8-18)30-22-11-10-20(13-21(22)24)29-26(32)28-15-17-6-5-9-19(27)12-17/h2-14H,15-16H2,1H3,(H2,28,29,32) |
| InChIKey | MOSLMARDSSSFKQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |