C25H20ClN3O4 — CID 46385061
methyl 2-[6-[(4-chlorophenyl)carbamoylamino]-2-phenylquinolin-4-yl]oxyacetate (PubChem CID 46385061) has the molecular formula C25H20ClN3O4 and a molecular weight of 461.91 g/mol. Its IUPAC name is methyl 2-[6-[(4-chlorophenyl)carbamoylamino]-2-phenylquinolin-4-yl]oxyacetate.
| Compound Name | methyl 2-[6-[(4-chlorophenyl)carbamoylamino]-2-phenylquinolin-4-yl]oxyacetate |
|---|---|
| PubChem CID | 46385061 |
| Molecular Formula | C25H20ClN3O4 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | methyl 2-[6-[(4-chlorophenyl)carbamoylamino]-2-phenylquinolin-4-yl]oxyacetate |
| SMILES | COC(=O)COc1cc(-c2ccccc2)nc2ccc(NC(=O)Nc3ccc(Cl)cc3)cc12 |
| InChI | InChI=1S/C25H20ClN3O4/c1-32-24(30)15-33-23-14-22(16-5-3-2-4-6-16)29-21-12-11-19(13-20(21)23)28-25(31)27-18-9-7-17(26)8-10-18/h2-14H,15H2,1H3,(H2,27,28,31) |
| InChIKey | NMOUTSQINGCWAE-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |