C23H21ClN2O4 — CID 53113645
methyl 2-[2-(4-chlorophenyl)-6-(cyclobutanecarbonylamino)quinolin-4-yl]oxyacetate (PubChem CID 53113645) has the molecular formula C23H21ClN2O4 and a molecular weight of 424.88 g/mol. Its IUPAC name is methyl 2-[2-(4-chlorophenyl)-6-(cyclobutanecarbonylamino)quinolin-4-yl]oxyacetate.
| Compound Name | methyl 2-[2-(4-chlorophenyl)-6-(cyclobutanecarbonylamino)quinolin-4-yl]oxyacetate |
|---|---|
| PubChem CID | 53113645 |
| Molecular Formula | C23H21ClN2O4 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | methyl 2-[2-(4-chlorophenyl)-6-(cyclobutanecarbonylamino)quinolin-4-yl]oxyacetate |
| SMILES | COC(=O)COc1cc(-c2ccc(Cl)cc2)nc2ccc(NC(=O)C3CCC3)cc12 |
| InChI | InChI=1S/C23H21ClN2O4/c1-29-22(27)13-30-21-12-20(14-5-7-16(24)8-6-14)26-19-10-9-17(11-18(19)21)25-23(28)15-3-2-4-15/h5-12,15H,2-4,13H2,1H3,(H,25,28) |
| InChIKey | VZZCSAANWGOWJD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |