C26H21ClN2O5 — CID 53113571
methyl 2-[6-[(3-chlorobenzoyl)amino]-2-(4-methoxyphenyl)quinolin-4-yl]oxyacetate (PubChem CID 53113571) has the molecular formula C26H21ClN2O5 and a molecular weight of 476.92 g/mol. Its IUPAC name is methyl 2-[6-[(3-chlorobenzoyl)amino]-2-(4-methoxyphenyl)quinolin-4-yl]oxyacetate.
| Compound Name | methyl 2-[6-[(3-chlorobenzoyl)amino]-2-(4-methoxyphenyl)quinolin-4-yl]oxyacetate |
|---|---|
| PubChem CID | 53113571 |
| Molecular Formula | C26H21ClN2O5 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | methyl 2-[6-[(3-chlorobenzoyl)amino]-2-(4-methoxyphenyl)quinolin-4-yl]oxyacetate |
| SMILES | COC(=O)COc1cc(-c2ccc(OC)cc2)nc2ccc(NC(=O)c3cccc(Cl)c3)cc12 |
| InChI | InChI=1S/C26H21ClN2O5/c1-32-20-9-6-16(7-10-20)23-14-24(34-15-25(30)33-2)21-13-19(8-11-22(21)29-23)28-26(31)17-4-3-5-18(27)12-17/h3-14H,15H2,1-2H3,(H,28,31) |
| InChIKey | XTIHFGSIIWVYDK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |