C27H25FN4O2 — CID 50836351
1-[(4-fluorophenyl)methyl]-3-(4-morpholin-4-yl-2-phenylquinolin-6-yl)urea (PubChem CID 50836351) has the molecular formula C27H25FN4O2 and a molecular weight of 456.52 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-(4-morpholin-4-yl-2-phenylquinolin-6-yl)urea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-(4-morpholin-4-yl-2-phenylquinolin-6-yl)urea |
|---|---|
| PubChem CID | 50836351 |
| Molecular Formula | C27H25FN4O2 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-(4-morpholin-4-yl-2-phenylquinolin-6-yl)urea |
| SMILES | O=C(NCc1ccc(F)cc1)Nc1ccc2nc(-c3ccccc3)cc(N3CCOCC3)c2c1 |
| InChI | InChI=1S/C27H25FN4O2/c28-21-8-6-19(7-9-21)18-29-27(33)30-22-10-11-24-23(16-22)26(32-12-14-34-15-13-32)17-25(31-24)20-4-2-1-3-5-20/h1-11,16-17H,12-15,18H2,(H2,29,30,33) |
| InChIKey | ZMAHPIVWDJBBDN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |