C23H18N2O2 — CID 50835495
4-methyl-N-[4-(4-phenyl-1,3-oxazol-2-yl)phenyl]benzamide (PubChem CID 50835495) has the molecular formula C23H18N2O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 4-methyl-N-[4-(4-phenyl-1,3-oxazol-2-yl)phenyl]benzamide.
| Compound Name | 4-methyl-N-[4-(4-phenyl-1,3-oxazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 50835495 |
| Molecular Formula | C23H18N2O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 4-methyl-N-[4-(4-phenyl-1,3-oxazol-2-yl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(-c3nc(-c4ccccc4)co3)cc2)cc1 |
| InChI | InChI=1S/C23H18N2O2/c1-16-7-9-18(10-8-16)22(26)24-20-13-11-19(12-14-20)23-25-21(15-27-23)17-5-3-2-4-6-17/h2-15H,1H3,(H,24,26) |
| InChIKey | PYYFGUVALNTLJH-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |