C23H17FN2O2 — CID 46377434
2-fluoro-N-[3-[4-(4-methylphenyl)-1,3-oxazol-2-yl]phenyl]benzamide (PubChem CID 46377434) has the molecular formula C23H17FN2O2 and a molecular weight of 372.40 g/mol. Its IUPAC name is 2-fluoro-N-[3-[4-(4-methylphenyl)-1,3-oxazol-2-yl]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[3-[4-(4-methylphenyl)-1,3-oxazol-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 46377434 |
| Molecular Formula | C23H17FN2O2 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-fluoro-N-[3-[4-(4-methylphenyl)-1,3-oxazol-2-yl]phenyl]benzamide |
| SMILES | Cc1ccc(-c2coc(-c3cccc(NC(=O)c4ccccc4F)c3)n2)cc1 |
| InChI | InChI=1S/C23H17FN2O2/c1-15-9-11-16(12-10-15)21-14-28-23(26-21)17-5-4-6-18(13-17)25-22(27)19-7-2-3-8-20(19)24/h2-14H,1H3,(H,25,27) |
| InChIKey | LTGJLGSHNAEUEJ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |