C22H18N4O2S — CID 11200464
N-[4-[5-(2-methoxyanilino)-1,3,4-thiadiazol-2-yl]phenyl]benzamide (PubChem CID 11200464) has the molecular formula C22H18N4O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is N-[4-[5-(2-methoxyanilino)-1,3,4-thiadiazol-2-yl]phenyl]benzamide.
| Compound Name | N-[4-[5-(2-methoxyanilino)-1,3,4-thiadiazol-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 11200464 |
| Molecular Formula | C22H18N4O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[4-[5-(2-methoxyanilino)-1,3,4-thiadiazol-2-yl]phenyl]benzamide |
| SMILES | COc1ccccc1Nc1nnc(-c2ccc(NC(=O)c3ccccc3)cc2)s1 |
| InChI | InChI=1S/C22H18N4O2S/c1-28-19-10-6-5-9-18(19)24-22-26-25-21(29-22)16-11-13-17(14-12-16)23-20(27)15-7-3-2-4-8-15/h2-14H,1H3,(H,23,27)(H,24,26) |
| InChIKey | OIGHXPMKWGULBF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |