C23H18BrN3O2S — CID 42764174
3-bromo-N-[4-[2-(2-methoxyanilino)-1,3-thiazol-4-yl]phenyl]benzamide (PubChem CID 42764174) has the molecular formula C23H18BrN3O2S and a molecular weight of 480.39 g/mol. Its IUPAC name is 3-bromo-N-[4-[2-(2-methoxyanilino)-1,3-thiazol-4-yl]phenyl]benzamide.
| Compound Name | 3-bromo-N-[4-[2-(2-methoxyanilino)-1,3-thiazol-4-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 42764174 |
| Molecular Formula | C23H18BrN3O2S |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | 3-bromo-N-[4-[2-(2-methoxyanilino)-1,3-thiazol-4-yl]phenyl]benzamide |
| SMILES | COc1ccccc1Nc1nc(-c2ccc(NC(=O)c3cccc(Br)c3)cc2)cs1 |
| InChI | InChI=1S/C23H18BrN3O2S/c1-29-21-8-3-2-7-19(21)26-23-27-20(14-30-23)15-9-11-18(12-10-15)25-22(28)16-5-4-6-17(24)13-16/h2-14H,1H3,(H,25,28)(H,26,27) |
| InChIKey | MIAOXVZXOBVPHW-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |