C22H18N2OS — CID 2303545
N-(2-methoxyphenyl)-4-(4-phenylphenyl)-1,3-thiazol-2-amine (PubChem CID 2303545) has the molecular formula C22H18N2OS and a molecular weight of 358.47 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-4-(4-phenylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(2-methoxyphenyl)-4-(4-phenylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2303545 |
| Molecular Formula | C22H18N2OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-(2-methoxyphenyl)-4-(4-phenylphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccccc1Nc1nc(-c2ccc(-c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C22H18N2OS/c1-25-21-10-6-5-9-19(21)23-22-24-20(15-26-22)18-13-11-17(12-14-18)16-7-3-2-4-8-16/h2-15H,1H3,(H,23,24) |
| InChIKey | OFNHICCOTMRLLO-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |