C18H17N5O2S2 — CID 46192880
1-[(2-methoxyphenyl)carbamothioylamino]-3-(4-phenyl-1,3-thiazol-2-yl)urea (PubChem CID 46192880) has the molecular formula C18H17N5O2S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)carbamothioylamino]-3-(4-phenyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-[(2-methoxyphenyl)carbamothioylamino]-3-(4-phenyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 46192880 |
| Molecular Formula | C18H17N5O2S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 1-[(2-methoxyphenyl)carbamothioylamino]-3-(4-phenyl-1,3-thiazol-2-yl)urea |
| SMILES | COc1ccccc1NC(=S)NNC(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H17N5O2S2/c1-25-15-10-6-5-9-13(15)19-17(26)23-22-16(24)21-18-20-14(11-27-18)12-7-3-2-4-8-12/h2-11H,1H3,(H2,19,23,26)(H2,20,21,22,24) |
| InChIKey | DNUYIEXZZMWPSH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|