C17H14ClN3O2S — CID 20896160
1-(5-chloro-2-methoxyphenyl)-3-(4-phenyl-1,3-thiazol-2-yl)urea (PubChem CID 20896160) has the molecular formula C17H14ClN3O2S and a molecular weight of 359.84 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-(4-phenyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-(4-phenyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 20896160 |
| Molecular Formula | C17H14ClN3O2S |
| Molecular Weight | 359.84 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-(4-phenyl-1,3-thiazol-2-yl)urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H14ClN3O2S/c1-23-15-8-7-12(18)9-13(15)19-16(22)21-17-20-14(10-24-17)11-5-3-2-4-6-11/h2-10H,1H3,(H2,19,20,21,22) |
| InChIKey | KHMSQAHZBWPJSC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.84 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |