C13H10N4O2 — CID 114214005
methyl 4-(3-cyanoanilino)pyrimidine-5-carboxylate (PubChem CID 114214005) has the molecular formula C13H10N4O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is methyl 4-(3-cyanoanilino)pyrimidine-5-carboxylate.
| Compound Name | methyl 4-(3-cyanoanilino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 114214005 |
| Molecular Formula | C13H10N4O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | methyl 4-(3-cyanoanilino)pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cncnc1Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C13H10N4O2/c1-19-13(18)11-7-15-8-16-12(11)17-10-4-2-3-9(5-10)6-14/h2-5,7-8H,1H3,(H,15,16,17) |
| InChIKey | DKVQVSONONGQAC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |