C20H15N5O3 — CID 109270197
methyl 2-[[2-(3-cyanoanilino)pyrimidine-5-carbonyl]amino]benzoate (PubChem CID 109270197) has the molecular formula C20H15N5O3 and a molecular weight of 373.37 g/mol. Its IUPAC name is methyl 2-[[2-(3-cyanoanilino)pyrimidine-5-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(3-cyanoanilino)pyrimidine-5-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109270197 |
| Molecular Formula | C20H15N5O3 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | methyl 2-[[2-(3-cyanoanilino)pyrimidine-5-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1cnc(Nc2cccc(C#N)c2)nc1 |
| InChI | InChI=1S/C20H15N5O3/c1-28-19(27)16-7-2-3-8-17(16)25-18(26)14-11-22-20(23-12-14)24-15-6-4-5-13(9-15)10-21/h2-9,11-12H,1H3,(H,25,26)(H,22,23,24) |
| InChIKey | QVUUZUMMFGWXJG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |