C20H17N5O — CID 109266441
2-(3-cyanoanilino)-N-(2,4-dimethylphenyl)pyrimidine-5-carboxamide (PubChem CID 109266441) has the molecular formula C20H17N5O and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-(3-cyanoanilino)-N-(2,4-dimethylphenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(3-cyanoanilino)-N-(2,4-dimethylphenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109266441 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-(3-cyanoanilino)-N-(2,4-dimethylphenyl)pyrimidine-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cnc(Nc3cccc(C#N)c3)nc2)c(C)c1 |
| InChI | InChI=1S/C20H17N5O/c1-13-6-7-18(14(2)8-13)25-19(26)16-11-22-20(23-12-16)24-17-5-3-4-15(9-17)10-21/h3-9,11-12H,1-2H3,(H,25,26)(H,22,23,24) |
| InChIKey | JQHQGIXKBPHRDY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |