C17H15N3O2 — CID 108986817
N'-(3-cyanophenyl)-N-(2,4-dimethylphenyl)oxamide (PubChem CID 108986817) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is N'-(3-cyanophenyl)-N-(2,4-dimethylphenyl)oxamide.
| Compound Name | N'-(3-cyanophenyl)-N-(2,4-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 108986817 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N'-(3-cyanophenyl)-N-(2,4-dimethylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)Nc2cccc(C#N)c2)c(C)c1 |
| InChI | InChI=1S/C17H15N3O2/c1-11-6-7-15(12(2)8-11)20-17(22)16(21)19-14-5-3-4-13(9-14)10-18/h3-9H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | USAZEWDRSJVQAN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|