C16H15BrN2O2 — CID 108515470
N-(3-bromophenyl)-N'-(2,4-dimethylphenyl)oxamide (PubChem CID 108515470) has the molecular formula C16H15BrN2O2 and a molecular weight of 347.21 g/mol. Its IUPAC name is N-(3-bromophenyl)-N'-(2,4-dimethylphenyl)oxamide.
| Compound Name | N-(3-bromophenyl)-N'-(2,4-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 108515470 |
| Molecular Formula | C16H15BrN2O2 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | N-(3-bromophenyl)-N'-(2,4-dimethylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)Nc2cccc(Br)c2)c(C)c1 |
| InChI | InChI=1S/C16H15BrN2O2/c1-10-6-7-14(11(2)8-10)19-16(21)15(20)18-13-5-3-4-12(17)9-13/h3-9H,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | KNRXJLLEBUPFII-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|