C17H14N4O2 — CID 110434481
3-[(7,8-dimethoxyquinazolin-4-yl)amino]benzonitrile (PubChem CID 110434481) has the molecular formula C17H14N4O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 3-[(7,8-dimethoxyquinazolin-4-yl)amino]benzonitrile.
| Compound Name | 3-[(7,8-dimethoxyquinazolin-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 110434481 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 3-[(7,8-dimethoxyquinazolin-4-yl)amino]benzonitrile |
| SMILES | COc1ccc2c(Nc3cccc(C#N)c3)ncnc2c1OC |
| InChI | InChI=1S/C17H14N4O2/c1-22-14-7-6-13-15(16(14)23-2)19-10-20-17(13)21-12-5-3-4-11(8-12)9-18/h3-8,10H,1-2H3,(H,19,20,21) |
| InChIKey | IJMKVFOEZALICH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |