C19H21N3O3 — CID 110434470
7,8-dimethoxy-N-(4-propoxyphenyl)quinazolin-4-amine (PubChem CID 110434470) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 7,8-dimethoxy-N-(4-propoxyphenyl)quinazolin-4-amine.
| Compound Name | 7,8-dimethoxy-N-(4-propoxyphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 110434470 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 7,8-dimethoxy-N-(4-propoxyphenyl)quinazolin-4-amine |
| SMILES | CCCOc1ccc(Nc2ncnc3c(OC)c(OC)ccc23)cc1 |
| InChI | InChI=1S/C19H21N3O3/c1-4-11-25-14-7-5-13(6-8-14)22-19-15-9-10-16(23-2)18(24-3)17(15)20-12-21-19/h5-10,12H,4,11H2,1-3H3,(H,20,21,22) |
| InChIKey | RPFNKLLCGUONLU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |