C15H21N3O2 — CID 155122341
7,8-dimethoxy-N-pentan-3-ylquinazolin-4-amine (PubChem CID 155122341) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 7,8-dimethoxy-N-pentan-3-ylquinazolin-4-amine.
| Compound Name | 7,8-dimethoxy-N-pentan-3-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 155122341 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 7,8-dimethoxy-N-pentan-3-ylquinazolin-4-amine |
| SMILES | CCC(CC)Nc1ncnc2c(OC)c(OC)ccc12 |
| InChI | InChI=1S/C15H21N3O2/c1-5-10(6-2)18-15-11-7-8-12(19-3)14(20-4)13(11)16-9-17-15/h7-10H,5-6H2,1-4H3,(H,16,17,18) |
| InChIKey | UASVJHJKCAJGHA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |