C18H18FN3O2 — CID 110431423
N-[2-(4-fluorophenyl)ethyl]-7,8-dimethoxyquinazolin-4-amine (PubChem CID 110431423) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-7,8-dimethoxyquinazolin-4-amine.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-7,8-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 110431423 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-7,8-dimethoxyquinazolin-4-amine |
| SMILES | COc1ccc2c(NCCc3ccc(F)cc3)ncnc2c1OC |
| InChI | InChI=1S/C18H18FN3O2/c1-23-15-8-7-14-16(17(15)24-2)21-11-22-18(14)20-10-9-12-3-5-13(19)6-4-12/h3-8,11H,9-10H2,1-2H3,(H,20,21,22) |
| InChIKey | JEGNASZEZMKWKJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |