C19H20FN3O4 — CID 18796778
N-[(3-fluoro-4-methoxyphenyl)methyl]-6,7,8-trimethoxyquinazolin-4-amine (PubChem CID 18796778) has the molecular formula C19H20FN3O4 and a molecular weight of 373.38 g/mol. Its IUPAC name is N-[(3-fluoro-4-methoxyphenyl)methyl]-6,7,8-trimethoxyquinazolin-4-amine.
| Compound Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-6,7,8-trimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 18796778 |
| Molecular Formula | C19H20FN3O4 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-6,7,8-trimethoxyquinazolin-4-amine |
| SMILES | COc1ccc(CNc2ncnc3c(OC)c(OC)c(OC)cc23)cc1F |
| InChI | InChI=1S/C19H20FN3O4/c1-24-14-6-5-11(7-13(14)20)9-21-19-12-8-15(25-2)17(26-3)18(27-4)16(12)22-10-23-19/h5-8,10H,9H2,1-4H3,(H,21,22,23) |
| InChIKey | VQPRCCROWZUYDO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |