C18H19N3O3 — CID 18796773
N-benzyl-6,7,8-trimethoxyquinazolin-4-amine (PubChem CID 18796773) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-benzyl-6,7,8-trimethoxyquinazolin-4-amine.
| Compound Name | N-benzyl-6,7,8-trimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 18796773 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-benzyl-6,7,8-trimethoxyquinazolin-4-amine |
| SMILES | COc1cc2c(NCc3ccccc3)ncnc2c(OC)c1OC |
| InChI | InChI=1S/C18H19N3O3/c1-22-14-9-13-15(17(24-3)16(14)23-2)20-11-21-18(13)19-10-12-7-5-4-6-8-12/h4-9,11H,10H2,1-3H3,(H,19,20,21) |
| InChIKey | ZGIXGZXRVWEURP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |