C16H19N5O3 — CID 18796736
N-[2-(1H-imidazol-5-yl)ethyl]-6,7,8-trimethoxyquinazolin-4-amine (PubChem CID 18796736) has the molecular formula C16H19N5O3 and a molecular weight of 329.36 g/mol. Its IUPAC name is N-[2-(1H-imidazol-5-yl)ethyl]-6,7,8-trimethoxyquinazolin-4-amine.
| Compound Name | N-[2-(1H-imidazol-5-yl)ethyl]-6,7,8-trimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 18796736 |
| Molecular Formula | C16H19N5O3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | N-[2-(1H-imidazol-5-yl)ethyl]-6,7,8-trimethoxyquinazolin-4-amine |
| SMILES | COc1cc2c(NCCc3cnc[nH]3)ncnc2c(OC)c1OC |
| InChI | InChI=1S/C16H19N5O3/c1-22-12-6-11-13(15(24-3)14(12)23-2)20-9-21-16(11)18-5-4-10-7-17-8-19-10/h6-9H,4-5H2,1-3H3,(H,17,19)(H,18,20,21) |
| InChIKey | TWUOVGUKZQWCIS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |