C22H25N3O4 — CID 18796676
6,7,8-trimethoxy-N-[(4-methoxy-3-prop-2-enylphenyl)methyl]quinazolin-4-amine (PubChem CID 18796676) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 6,7,8-trimethoxy-N-[(4-methoxy-3-prop-2-enylphenyl)methyl]quinazolin-4-amine.
| Compound Name | 6,7,8-trimethoxy-N-[(4-methoxy-3-prop-2-enylphenyl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 18796676 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 6,7,8-trimethoxy-N-[(4-methoxy-3-prop-2-enylphenyl)methyl]quinazolin-4-amine |
| SMILES | C=CCc1cc(CNc2ncnc3c(OC)c(OC)c(OC)cc23)ccc1OC |
| InChI | InChI=1S/C22H25N3O4/c1-6-7-15-10-14(8-9-17(15)26-2)12-23-22-16-11-18(27-3)20(28-4)21(29-5)19(16)24-13-25-22/h6,8-11,13H,1,7,12H2,2-5H3,(H,23,24,25) |
| InChIKey | QEEKNMKCRBJPLB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|