C19H21N3O4 — CID 18796791
6,7,8-trimethoxy-N-[(3-methoxyphenyl)methyl]quinazolin-4-amine (PubChem CID 18796791) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 6,7,8-trimethoxy-N-[(3-methoxyphenyl)methyl]quinazolin-4-amine.
| Compound Name | 6,7,8-trimethoxy-N-[(3-methoxyphenyl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 18796791 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 6,7,8-trimethoxy-N-[(3-methoxyphenyl)methyl]quinazolin-4-amine |
| SMILES | COc1cccc(CNc2ncnc3c(OC)c(OC)c(OC)cc23)c1 |
| InChI | InChI=1S/C19H21N3O4/c1-23-13-7-5-6-12(8-13)10-20-19-14-9-15(24-2)17(25-3)18(26-4)16(14)21-11-22-19/h5-9,11H,10H2,1-4H3,(H,20,21,22) |
| InChIKey | IATGPZYGDJTYBV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |