About 3-[(7-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]benzonitrile
3-[(7-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]benzonitrile (PubChem CID 24735991) has the molecular formula C14H10N4S
and a molecular weight of 266.33 g/mol. Its IUPAC name is 3-[(7-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]benzonitrile.
Molecular Properties
| Compound Name | 3-[(7-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]benzonitrile |
| PubChem CID | 24735991 |
| Molecular Formula | C14H10N4S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 3-[(7-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]benzonitrile |
| SMILES | Cc1ccnc2sc(Nc3cccc(C#N)c3)nc12 |
| InChI | InChI=1S/C14H10N4S/c1-9-5-6-16-13-12(9)18-14(19-13)17-11-4-2-3-10(7-11)8-15/h2-7H,1H3,(H,17,18) |
| InChIKey | ZSMXULOKPDYVNW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(7-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(7-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]benzonitrile?
The IUPAC name of 3-[(7-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]benzonitrile (CID 24735991) is 3-[(7-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]benzonitrile.
What is the SMILES notation for 3-[(7-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]benzonitrile?
The canonical SMILES for 3-[(7-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]benzonitrile is Cc1ccnc2sc(Nc3cccc(C#N)c3)nc12.
What is the InChIKey of 3-[(7-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]benzonitrile?
The InChIKey is ZSMXULOKPDYVNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4S/c1-9-5-6-16-13-12(9)18-14(19-13)17-11-4-2-3-10(7-11)8-15/h2-7H,1H3,(H,17,18).
What are the key properties of 3-[(7-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]benzonitrile?
3-[(7-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]benzonitrile has a molecular weight of 266.33 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(7-methyl-[1,3]thiazolo[5,4-b]pyridin-2-yl)amino]benzonitrile is sourced from PubChem (CID 24735991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).