C13H10N2O3 — CID 62312630
5-[(3-cyanophenyl)methylamino]furan-2-carboxylic acid (PubChem CID 62312630) has the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. Its IUPAC name is 5-[(3-cyanophenyl)methylamino]furan-2-carboxylic acid.
| Compound Name | 5-[(3-cyanophenyl)methylamino]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 62312630 |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 5-[(3-cyanophenyl)methylamino]furan-2-carboxylic acid |
| SMILES | N#Cc1cccc(CNc2ccc(C(=O)O)o2)c1 |
| InChI | InChI=1S/C13H10N2O3/c14-7-9-2-1-3-10(6-9)8-15-12-5-4-11(18-12)13(16)17/h1-6,15H,8H2,(H,16,17) |
| InChIKey | KAWMFGUBLWXUDW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 86.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |