C15H17N3OS — CID 96710401
5-ethoxy-N-propyl-[1,3]thiazolo[4,5-f]quinolin-2-amine (PubChem CID 96710401) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 5-ethoxy-N-propyl-[1,3]thiazolo[4,5-f]quinolin-2-amine.
| Compound Name | 5-ethoxy-N-propyl-[1,3]thiazolo[4,5-f]quinolin-2-amine |
|---|---|
| PubChem CID | 96710401 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 5-ethoxy-N-propyl-[1,3]thiazolo[4,5-f]quinolin-2-amine |
| SMILES | CCCNc1nc2c(cc(OCC)c3ncccc32)s1 |
| InChI | InChI=1S/C15H17N3OS/c1-3-7-17-15-18-14-10-6-5-8-16-13(10)11(19-4-2)9-12(14)20-15/h5-6,8-9H,3-4,7H2,1-2H3,(H,17,18) |
| InChIKey | MINJWXABYLVPJD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |