C16H24N2O3S — CID 96710391
4,5,6-triethoxy-N-propyl-1,3-benzothiazol-2-amine (PubChem CID 96710391) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 4,5,6-triethoxy-N-propyl-1,3-benzothiazol-2-amine.
| Compound Name | 4,5,6-triethoxy-N-propyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 96710391 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 4,5,6-triethoxy-N-propyl-1,3-benzothiazol-2-amine |
| SMILES | CCCNc1nc2c(OCC)c(OCC)c(OCC)cc2s1 |
| InChI | InChI=1S/C16H24N2O3S/c1-5-9-17-16-18-13-12(22-16)10-11(19-6-2)14(20-7-3)15(13)21-8-4/h10H,5-9H2,1-4H3,(H,17,18) |
| InChIKey | DEAYAQDNYSVBKW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |