C12H15ClN2O2S — CID 82549360
6-chloro-4,7-dimethoxy-N-propyl-1,3-benzothiazol-2-amine (PubChem CID 82549360) has the molecular formula C12H15ClN2O2S and a molecular weight of 286.78 g/mol. Its IUPAC name is 6-chloro-4,7-dimethoxy-N-propyl-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-4,7-dimethoxy-N-propyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82549360 |
| Molecular Formula | C12H15ClN2O2S |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 6-chloro-4,7-dimethoxy-N-propyl-1,3-benzothiazol-2-amine |
| SMILES | CCCNc1nc2c(OC)cc(Cl)c(OC)c2s1 |
| InChI | InChI=1S/C12H15ClN2O2S/c1-4-5-14-12-15-9-8(16-2)6-7(13)10(17-3)11(9)18-12/h6H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | TXUMNZKELARGOL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |