C10H11ClN2O2S — CID 82549451
7-chloro-4,6-dimethoxy-N-methyl-1,3-benzothiazol-2-amine (PubChem CID 82549451) has the molecular formula C10H11ClN2O2S and a molecular weight of 258.73 g/mol. Its IUPAC name is 7-chloro-4,6-dimethoxy-N-methyl-1,3-benzothiazol-2-amine.
| Compound Name | 7-chloro-4,6-dimethoxy-N-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82549451 |
| Molecular Formula | C10H11ClN2O2S |
| Molecular Weight | 258.73 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 7-chloro-4,6-dimethoxy-N-methyl-1,3-benzothiazol-2-amine |
| SMILES | CNc1nc2c(OC)cc(OC)c(Cl)c2s1 |
| InChI | InChI=1S/C10H11ClN2O2S/c1-12-10-13-8-6(15-3)4-5(14-2)7(11)9(8)16-10/h4H,1-3H3,(H,12,13) |
| InChIKey | NNENBCISFBCGNV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.73 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |