C10H10Cl2N2OS — CID 82548636
5,7-dichloro-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine (PubChem CID 82548636) has the molecular formula C10H10Cl2N2OS and a molecular weight of 277.18 g/mol. Its IUPAC name is 5,7-dichloro-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine.
| Compound Name | 5,7-dichloro-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82548636 |
| Molecular Formula | C10H10Cl2N2OS |
| Molecular Weight | 277.18 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 5,7-dichloro-4-ethoxy-N-methyl-1,3-benzothiazol-2-amine |
| SMILES | CCOc1c(Cl)cc(Cl)c2sc(NC)nc12 |
| InChI | InChI=1S/C10H10Cl2N2OS/c1-3-15-8-5(11)4-6(12)9-7(8)14-10(13-2)16-9/h4H,3H2,1-2H3,(H,13,14) |
| InChIKey | IDPQICZOLUYKAA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.18 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |