C14H19ClN2O2S — CID 82548540
6-chloro-N-methyl-4,7-dipropoxy-1,3-benzothiazol-2-amine (PubChem CID 82548540) has the molecular formula C14H19ClN2O2S and a molecular weight of 314.84 g/mol. Its IUPAC name is 6-chloro-N-methyl-4,7-dipropoxy-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-N-methyl-4,7-dipropoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82548540 |
| Molecular Formula | C14H19ClN2O2S |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 6-chloro-N-methyl-4,7-dipropoxy-1,3-benzothiazol-2-amine |
| SMILES | CCCOc1cc(Cl)c(OCCC)c2sc(NC)nc12 |
| InChI | InChI=1S/C14H19ClN2O2S/c1-4-6-18-10-8-9(15)12(19-7-5-2)13-11(10)17-14(16-3)20-13/h8H,4-7H2,1-3H3,(H,16,17) |
| InChIKey | XNLOHQJBRUEKQE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |