C12H14Cl2N2OS — CID 82548631
5,7-dichloro-N-ethyl-4-propoxy-1,3-benzothiazol-2-amine (PubChem CID 82548631) has the molecular formula C12H14Cl2N2OS and a molecular weight of 305.23 g/mol. Its IUPAC name is 5,7-dichloro-N-ethyl-4-propoxy-1,3-benzothiazol-2-amine.
| Compound Name | 5,7-dichloro-N-ethyl-4-propoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82548631 |
| Molecular Formula | C12H14Cl2N2OS |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 5,7-dichloro-N-ethyl-4-propoxy-1,3-benzothiazol-2-amine |
| SMILES | CCCOc1c(Cl)cc(Cl)c2sc(NCC)nc12 |
| InChI | InChI=1S/C12H14Cl2N2OS/c1-3-5-17-10-7(13)6-8(14)11-9(10)16-12(18-11)15-4-2/h6H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | CAKDYGRXNFEOPT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |