C13H14Cl2N2O — CID 70883664
8-butoxy-5,7-dichloro-2-methylquinoxaline (PubChem CID 70883664) has the molecular formula C13H14Cl2N2O and a molecular weight of 285.17 g/mol. Its IUPAC name is 8-butoxy-5,7-dichloro-2-methylquinoxaline.
| Compound Name | 8-butoxy-5,7-dichloro-2-methylquinoxaline |
|---|---|
| PubChem CID | 70883664 |
| Molecular Formula | C13H14Cl2N2O |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 8-butoxy-5,7-dichloro-2-methylquinoxaline |
| SMILES | CCCCOc1c(Cl)cc(Cl)c2ncc(C)nc12 |
| InChI | InChI=1S/C13H14Cl2N2O/c1-3-4-5-18-13-10(15)6-9(14)11-12(13)17-8(2)7-16-11/h6-7H,3-5H2,1-2H3 |
| InChIKey | OETSNKVJPWQHMI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|