About (4-butoxy-3,5-dichlorophenyl)methyl-propylazanium
(4-butoxy-3,5-dichlorophenyl)methyl-propylazanium (PubChem CID 2236966) has the molecular formula C14H22Cl2NO+
and a molecular weight of 291.24 g/mol. Its IUPAC name is (4-butoxy-3,5-dichlorophenyl)methyl-propylazanium.
Molecular Properties
| Compound Name | (4-butoxy-3,5-dichlorophenyl)methyl-propylazanium |
| PubChem CID | 2236966 |
| Molecular Formula | C14H22Cl2NO+ |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (4-butoxy-3,5-dichlorophenyl)methyl-propylazanium |
| SMILES | CCCCOc1c(Cl)cc(C[NH2+]CCC)cc1Cl |
| InChI | InChI=1S/C14H21Cl2NO/c1-3-5-7-18-14-12(15)8-11(9-13(14)16)10-17-6-4-2/h8-9,17H,3-7,10H2,1-2H3/p+1 |
| InChIKey | QKHAKDWVHISVDR-UHFFFAOYSA-O |
| XLogP | 3.65 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-butoxy-3,5-dichlorophenyl)methyl-propylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-butoxy-3,5-dichlorophenyl)methyl-propylazanium?
The IUPAC name of (4-butoxy-3,5-dichlorophenyl)methyl-propylazanium (CID 2236966) is (4-butoxy-3,5-dichlorophenyl)methyl-propylazanium.
What is the SMILES notation for (4-butoxy-3,5-dichlorophenyl)methyl-propylazanium?
The canonical SMILES for (4-butoxy-3,5-dichlorophenyl)methyl-propylazanium is CCCCOc1c(Cl)cc(C[NH2+]CCC)cc1Cl.
What is the InChIKey of (4-butoxy-3,5-dichlorophenyl)methyl-propylazanium?
The InChIKey is QKHAKDWVHISVDR-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H21Cl2NO/c1-3-5-7-18-14-12(15)8-11(9-13(14)16)10-17-6-4-2/h8-9,17H,3-7,10H2,1-2H3/p+1.
What are the key properties of (4-butoxy-3,5-dichlorophenyl)methyl-propylazanium?
(4-butoxy-3,5-dichlorophenyl)methyl-propylazanium has a molecular weight of 291.24 g/mol, XLogP of 3.65, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butoxy-3,5-dichlorophenyl)methyl-propylazanium is sourced from PubChem (CID 2236966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).