C18H31ClN2O3+2 — CID 7458493
(3-chloro-4,5-diethoxyphenyl)methyl-(3-morpholin-4-ium-4-ylpropyl)azanium (PubChem CID 7458493) has the molecular formula C18H31ClN2O3+2 and a molecular weight of 358.91 g/mol. Its IUPAC name is (3-chloro-4,5-diethoxyphenyl)methyl-(3-morpholin-4-ium-4-ylpropyl)azanium.
| Compound Name | (3-chloro-4,5-diethoxyphenyl)methyl-(3-morpholin-4-ium-4-ylpropyl)azanium |
|---|---|
| PubChem CID | 7458493 |
| Molecular Formula | C18H31ClN2O3+2 |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (3-chloro-4,5-diethoxyphenyl)methyl-(3-morpholin-4-ium-4-ylpropyl)azanium |
| SMILES | CCOc1cc(C[NH2+]CCC[NH+]2CCOCC2)cc(Cl)c1OCC |
| InChI | InChI=1S/C18H29ClN2O3/c1-3-23-17-13-15(12-16(19)18(17)24-4-2)14-20-6-5-7-21-8-10-22-11-9-21/h12-13,20H,3-11,14H2,1-2H3/p+2 |
| InChIKey | ABGQCHQNCLMHSL-UHFFFAOYSA-P |
| XLogP | 0.51 |
| TPSA | 48.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|