C22H31ClN2O3+2 — CID 7458363
[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methyl-(3-morpholin-4-ium-4-ylpropyl)azanium (PubChem CID 7458363) has the molecular formula C22H31ClN2O3+2 and a molecular weight of 406.95 g/mol. Its IUPAC name is [2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methyl-(3-morpholin-4-ium-4-ylpropyl)azanium.
| Compound Name | [2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methyl-(3-morpholin-4-ium-4-ylpropyl)azanium |
|---|---|
| PubChem CID | 7458363 |
| Molecular Formula | C22H31ClN2O3+2 |
| Molecular Weight | 406.95 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | [2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methyl-(3-morpholin-4-ium-4-ylpropyl)azanium |
| SMILES | COc1cccc(C[NH2+]CCC[NH+]2CCOCC2)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C22H29ClN2O3/c1-26-21-9-4-7-18(16-24-10-5-11-25-12-14-27-15-13-25)22(21)28-17-19-6-2-3-8-20(19)23/h2-4,6-9,24H,5,10-17H2,1H3/p+2 |
| InChIKey | CBEIRONOJMSRFT-UHFFFAOYSA-P |
| XLogP | 1.30 |
| TPSA | 48.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.95 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|