C21H29Cl2FN2O3 — CID 44666038
[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl-(2-morpholin-4-ium-4-ylethyl)azanium dichloride (PubChem CID 44666038) has the molecular formula C21H29Cl2FN2O3 and a molecular weight of 447.38 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl-(2-morpholin-4-ium-4-ylethyl)azanium dichloride.
| Compound Name | [2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl-(2-morpholin-4-ium-4-ylethyl)azanium dichloride |
|---|---|
| PubChem CID | 44666038 |
| Molecular Formula | C21H29Cl2FN2O3 |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | [2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl-(2-morpholin-4-ium-4-ylethyl)azanium dichloride |
| SMILES | COc1cccc(C[NH2+]CC[NH+]2CCOCC2)c1OCc1ccc(F)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C21H27FN2O3.2ClH/c1-25-20-4-2-3-18(15-23-9-10-24-11-13-26-14-12-24)21(20)27-16-17-5-7-19(22)8-6-17;;/h2-8,23H,9-16H2,1H3;2*1H |
| InChIKey | ZQNCVMVXACYWMY-UHFFFAOYSA-N |
| XLogP | -5.60 |
| TPSA | 48.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | -5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|